CAS 2410797-86-1 is the registry number for (S)-3-(Methoxymethyl)-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-7-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-3-(methoxymethyl)-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-7-carboxylic acid (CAS 2410797-86-1) is a chemical compound with the molecular formula C10H13NO4 and a molecular weight of 211.21 g/mol. IUPAC name: (3S)-3-(methoxymethyl)-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-7-carboxylic acid. InChIKey: SRYOWNIQXFHARD-VIFPVBQESA-N.
| Molecular formula | C10H13NO4 |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | (3S)-3-(methoxymethyl)-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]oxazine-7-carboxylic acid |
| InChIKey | SRYOWNIQXFHARD-VIFPVBQESA-N |
| SMILES | COC[C@@H]1CN2C=C(C=C2CO1)C(=O)O |
Computed by PubChem (NCBI)