Products 2410984-36-8
CAS 2410984-36-8 is the registry number for 3-Benzyl 2-(tert-butyl) (1S,3S,4S,5R)-5-hydroxy-2-azabicyclo[2.2.2]octane-2,3-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-O-benzyl 2-O-tert-butyl (1S,3S,4S,5R)-5-hydroxy-2-azabicyclo[2.2.2]octane-2,3-dicarboxylate (CAS 2410984-36-8) is a chemical compound with the molecular formula C20H27NO5 and a molecular weight of 361.4 g/mol. IUPAC name: 3-O-benzyl 2-O-tert-butyl (1S,3S,4S,5R)-5-hydroxy-2-azabicyclo[2.2.2]octane-2,3-dicarboxylate. InChIKey: WHUYTZRSFPQBQH-HZMVEIRTSA-N.
| Molecular formula | C20H27NO5 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | 3-O-benzyl 2-O-tert-butyl (1S,3S,4S,5R)-5-hydroxy-2-azabicyclo[2.2.2]octane-2,3-dicarboxylate |
| InChIKey | WHUYTZRSFPQBQH-HZMVEIRTSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H]2CC[C@@H]([C@H]1C(=O)OCC3=CC=CC=C3)[C@@H](C2)O |
Computed by PubChem (NCBI)