Products 948033-75-8
CAS 948033-75-8 is the registry number for tert-Butyl 5,6-dimethoxy-3-oxo-2,3-dihydrospiro[indene-1,4'-piperidine]-1'-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl 5,6-dimethoxy-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylate (CAS 948033-75-8) is a chemical compound with the molecular formula C20H27NO5 and a molecular weight of 361.4 g/mol. IUPAC name: tert-butyl 5,6-dimethoxy-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylate. InChIKey: ZLVHLKCLZIAUKY-UHFFFAOYSA-N.
| Molecular formula | C20H27NO5 |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | tert-butyl 5,6-dimethoxy-3-oxospiro[2H-indene-1,4'-piperidine]-1'-carboxylate |
| InChIKey | ZLVHLKCLZIAUKY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC(=O)C3=CC(=C(C=C23)OC)OC |
Computed by PubChem (NCBI)