Products 219324-21-7

CAS 219324-21-7 is the registry number for 1-tert-Butyl 3-ethyl 3-benzyl-4-oxopiperidine-1,3-dicarboxylate. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 3-O-ethyl 3-benzyl-4-oxopiperidine-1,3-dicarboxylate (CAS 219324-21-7) is a chemical compound with the molecular formula C20H27NO5 and a molecular weight of 361.4 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl 3-benzyl-4-oxopiperidine-1,3-dicarboxylate. InChIKey: NTXNVZIFOWTIBP-UHFFFAOYSA-N.

Identity
Molecular formulaC20H27NO5
Molecular weight361.4 g/mol
IUPAC name1-O-tert-butyl 3-O-ethyl 3-benzyl-4-oxopiperidine-1,3-dicarboxylate
InChIKeyNTXNVZIFOWTIBP-UHFFFAOYSA-N
SMILESCCOC(=O)C1(CN(CCC1=O)C(=O)OC(C)(C)C)CC2=CC=CC=C2

Computed by PubChem (NCBI)