Products 2411296-56-3

CAS 2411296-56-3 is the registry number for 2,2-Difluoro-3-methylbicyclo[1.1.1]pentane-1-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,2-difluoro-3-methylbicyclo[1.1.1]pentane-1-carboxylic acid (CAS 2411296-56-3) is a chemical compound with the molecular formula C7H8F2O2 and a molecular weight of 162.13 g/mol. IUPAC name: 2,2-difluoro-3-methylbicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: RTZFDDBSRPQHOX-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8F2O2
Molecular weight162.13 g/mol
IUPAC name2,2-difluoro-3-methylbicyclo[1.1.1]pentane-1-carboxylic acid
InChIKeyRTZFDDBSRPQHOX-UHFFFAOYSA-N
SMILESCC12CC(C1)(C2(F)F)C(=O)O

Computed by PubChem (NCBI)