Products 2744526-57-4
CAS 2744526-57-4 is the registry number for Rel-(1R,2S)-3,3-difluoro-[1,1'-bi(cyclopropane)]-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(1R,3S)-3-cyclopropyl-2,2-difluorocyclopropane-1-carboxylic acid (CAS 2744526-57-4) is a chemical compound with the molecular formula C7H8F2O2 and a molecular weight of 162.13 g/mol. IUPAC name: cis-(1R,3S)-3-cyclopropyl-2,2-difluorocyclopropane-1-carboxylic acid. InChIKey: YYBBGDJIMVLIDH-CRCLSJGQSA-N.
| Molecular formula | C7H8F2O2 |
|---|---|
| Molecular weight | 162.13 g/mol |
| IUPAC name | cis-(1R,3S)-3-cyclopropyl-2,2-difluorocyclopropane-1-carboxylic acid |
| InChIKey | YYBBGDJIMVLIDH-CRCLSJGQSA-N |
| SMILES | C1CC1[C@H]2[C@@H](C2(F)F)C(=O)O |
Computed by PubChem (NCBI)