CAS 2411506-35-7 is the registry number for Bictegravir Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-hydroxy-1-[(1R,4S)-2-oxa-3-azabicyclo[2.2.1]heptan-3-yl]-2-phenylethanone (CAS 2411506-35-7) is a chemical compound with the molecular formula C13H15NO3 and a molecular weight of 233.26 g/mol. IUPAC name: (2R)-2-hydroxy-1-[(1R,4S)-2-oxa-3-azabicyclo[2.2.1]heptan-3-yl]-2-phenylethanone. InChIKey: QPPSINBVIBSVHS-QJPTWQEYSA-N.
| Molecular formula | C13H15NO3 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | (2R)-2-hydroxy-1-[(1R,4S)-2-oxa-3-azabicyclo[2.2.1]heptan-3-yl]-2-phenylethanone |
| InChIKey | QPPSINBVIBSVHS-QJPTWQEYSA-N |
| SMILES | C1C[C@@H]2C[C@H]1N(O2)C(=O)[C@@H](C3=CC=CC=C3)O |
Computed by PubChem (NCBI)