CAS 2411591-29-0 appears in our catalog under these names: Fmoc-D-hGln(Trt)-OH 95%, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-6-oxo-6-(tritylamino)hexanoic acid, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-oxo-6-(tritylamino)hexanoic acid (CAS 2411591-29-0) is a chemical compound with the molecular formula C40H36N2O5 and a molecular weight of 624.7 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-oxo-6-(tritylamino)hexanoic acid. InChIKey: NFAHDTODHGODCZ-PSXMRANNSA-N.
| Molecular formula | C40H36N2O5 |
|---|---|
| Molecular weight | 624.7 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-oxo-6-(tritylamino)hexanoic acid |
| InChIKey | NFAHDTODHGODCZ-PSXMRANNSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NC(=O)CCC[C@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)