CAS 401915-55-7 appears in our catalog under these names: Fmoc–β–HoGln(Trt)–OH, Fmoc-L-beta-HGln(Trt)-OH, Fmoc-β-HoGln(Trt)-OH 98%, Fmoc-β-HoGln(Trt)-OH, 98%, 98%, Fmoc-β-HoGln(Trt)-OH, 98%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 25g, 10g.
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-6-oxo-6-(tritylamino)hexanoic acid (CAS 401915-55-7) is a chemical compound with the molecular formula C40H36N2O5 and a molecular weight of 624.7 g/mol. IUPAC name: (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-6-oxo-6-(tritylamino)hexanoic acid. InChIKey: YWEDBQXENWAMAS-HKBQPEDESA-N.
| Molecular formula | C40H36N2O5 |
|---|---|
| Molecular weight | 624.7 g/mol |
| IUPAC name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-6-oxo-6-(tritylamino)hexanoic acid |
| InChIKey | YWEDBQXENWAMAS-HKBQPEDESA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NC(=O)CC[C@@H](CC(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)