CAS 2411591-47-2 is the registry number for (R)–2–Amino–2–(3,4–dimethoxyphenyl)ethan–1–ol hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg.
(2R)-2-amino-2-(3,4-dimethoxyphenyl)ethanol;hydrochloride (CAS 2411591-47-2) is a chemical compound with the molecular formula C10H16ClNO3 and a molecular weight of 233.69 g/mol. IUPAC name: (2R)-2-amino-2-(3,4-dimethoxyphenyl)ethanol;hydrochloride. InChIKey: NCRZWUIMVNDOMZ-QRPNPIFTSA-N.
| Molecular formula | C10H16ClNO3 |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | (2R)-2-amino-2-(3,4-dimethoxyphenyl)ethanol;hydrochloride |
| InChIKey | NCRZWUIMVNDOMZ-QRPNPIFTSA-N |
| SMILES | COC1=C(C=C(C=C1)[C@H](CO)N)OC.Cl |
Computed by PubChem (NCBI)