CAS 24121-01-5 is the registry number for 2′-O-Methylguanosine 5′-monophosphate. Offered by: MedChemExpress. Available pack sizes: Get quote.
2'-O-methylguanosine 5'-monophosphate is a guanosine 5'-phosphate that is the 2'-O-methyl derivative of guanosine 5'-monophosphate. It is functionally related to a guanosine 5'-monophosphate.
Source: ChEBI
| Molecular formula | C11H16N5O8P |
|---|---|
| Molecular weight | 377.25 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxy-4-methoxyoxolan-2-yl]methyl dihydrogen phosphate |
| InChIKey | YPMKZCOIEXUDSS-KQYNXXCUSA-N |
| SMILES | CO[C@@H]1[C@@H]([C@H](O[C@H]1N2C=NC3=C2N=C(NC3=O)N)COP(=O)(O)O)O |
Computed by PubChem (NCBI)