CAS 400806-41-9 appears in our catalog under these names: 3'-O-Methyl-5'-guanylic acid, 3'-O-Methylguanosine-5'-monophosphate. Offered by: Biosynth, MedChemExpress. Available pack sizes: 2g, 1g, 5g, 10g, Get quote.
[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-3-methoxyoxolan-2-yl]methyl dihydrogen phosphate (CAS 400806-41-9) is a chemical compound with the molecular formula C11H16N5O8P and a molecular weight of 377.25 g/mol. IUPAC name: [(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-3-methoxyoxolan-2-yl]methyl dihydrogen phosphate. InChIKey: JGYKGFFURACNNS-KQYNXXCUSA-N.
| Molecular formula | C11H16N5O8P |
|---|---|
| Molecular weight | 377.25 g/mol |
| IUPAC name | [(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-3-methoxyoxolan-2-yl]methyl dihydrogen phosphate |
| InChIKey | JGYKGFFURACNNS-KQYNXXCUSA-N |
| SMILES | CO[C@@H]1[C@H](O[C@H]([C@@H]1O)N2C=NC3=C2N=C(NC3=O)N)COP(=O)(O)O |
Computed by PubChem (NCBI)