Products 2412108-25-7

CAS 2412108-25-7 is the registry number for 5-(2-(Ethoxycarbonyl)cyclopropyl)-2-fluoro-4-methylbenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-(2-ethoxycarbonylcyclopropyl)-2-fluoro-4-methylbenzoic acid (CAS 2412108-25-7) is a chemical compound with the molecular formula C14H15FO4 and a molecular weight of 266.26 g/mol. IUPAC name: 5-(2-ethoxycarbonylcyclopropyl)-2-fluoro-4-methylbenzoic acid. InChIKey: AUAVTCLOUHSBLE-UHFFFAOYSA-N.

Identity
Molecular formulaC14H15FO4
Molecular weight266.26 g/mol
IUPAC name5-(2-ethoxycarbonylcyclopropyl)-2-fluoro-4-methylbenzoic acid
InChIKeyAUAVTCLOUHSBLE-UHFFFAOYSA-N
SMILESCCOC(=O)C1CC1C2=CC(=C(C=C2C)F)C(=O)O

Computed by PubChem (NCBI)