CAS 797054-21-8 is the registry number for (1’S,2R)-2-((1’,2’-O-Isopropylidene)dihydroxyethyl)-6-fluorochroman-4-one. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
(2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-fluoro-2,3-dihydrochromen-4-one (CAS 797054-21-8) is a chemical compound with the molecular formula C14H15FO4 and a molecular weight of 266.26 g/mol. IUPAC name: (2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-fluoro-2,3-dihydrochromen-4-one. InChIKey: MYQKUOXZBKPFPP-OLZOCXBDSA-N.
| Molecular formula | C14H15FO4 |
|---|---|
| Molecular weight | 266.26 g/mol |
| IUPAC name | (2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-fluoro-2,3-dihydrochromen-4-one |
| InChIKey | MYQKUOXZBKPFPP-OLZOCXBDSA-N |
| SMILES | CC1(OC[C@H](O1)[C@H]2CC(=O)C3=C(O2)C=CC(=C3)F)C |
Computed by PubChem (NCBI)