Products 2412856-87-0
CAS 2412856-87-0 is the registry number for tert-Butyl (S)-6-oxohexahydropyrrolo[1,2-a]pyrazine-2(1H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (8aS)-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carboxylate (CAS 2412856-87-0) is a chemical compound with the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. IUPAC name: tert-butyl (8aS)-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carboxylate. InChIKey: HHGDFOURWVOVPO-VIFPVBQESA-N.
| Molecular formula | C12H20N2O3 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | tert-butyl (8aS)-6-oxo-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-2-carboxylate |
| InChIKey | HHGDFOURWVOVPO-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN2[C@H](C1)CCC2=O |
Computed by PubChem (NCBI)