Products 2413006-48-9
CAS 2413006-48-9 is the registry number for Antibacterial agent 95. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(3-chlorophenyl)-2-(6-methoxy-2-methylquinolin-4-yl)oxyethanone (CAS 2413006-48-9) is a chemical compound with the molecular formula C19H16ClNO3 and a molecular weight of 341.8 g/mol. IUPAC name: 1-(3-chlorophenyl)-2-(6-methoxy-2-methylquinolin-4-yl)oxyethanone. InChIKey: SNXDJHDIXKVNFR-UHFFFAOYSA-N.
| Molecular formula | C19H16ClNO3 |
|---|---|
| Molecular weight | 341.8 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-2-(6-methoxy-2-methylquinolin-4-yl)oxyethanone |
| InChIKey | SNXDJHDIXKVNFR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=C(C=CC2=N1)OC)OCC(=O)C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)
Synonyms:
Antibacterial agent 95, orb1688941