Products 2413407-82-4
CAS 2413407-82-4 is the registry number for 5-(Difluoromethyl)-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(difluoromethyl)-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-2-carboxylic acid (CAS 2413407-82-4) is a chemical compound with the molecular formula C8H8F2N2O3 and a molecular weight of 218.16 g/mol. IUPAC name: 5-(difluoromethyl)-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-2-carboxylic acid. InChIKey: WLNRYJYAMKFOGY-UHFFFAOYSA-N.
| Molecular formula | C8H8F2N2O3 |
|---|---|
| Molecular weight | 218.16 g/mol |
| IUPAC name | 5-(difluoromethyl)-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazine-2-carboxylic acid |
| InChIKey | WLNRYJYAMKFOGY-UHFFFAOYSA-N |
| SMILES | C1CN2C(=CC(=N2)C(=O)O)OC1C(F)F |
Computed by PubChem (NCBI)