CAS 832738-23-5 is the registry number for 3-(2,2-Difluoroethoxy)-5-nitroaniline. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-(2,2-difluoroethoxy)-5-nitroaniline (CAS 832738-23-5) is a chemical compound with the molecular formula C8H8F2N2O3 and a molecular weight of 218.16 g/mol. IUPAC name: 3-(2,2-difluoroethoxy)-5-nitroaniline. InChIKey: NKVLRUWGBCMVPU-UHFFFAOYSA-N.
| Molecular formula | C8H8F2N2O3 |
|---|---|
| Molecular weight | 218.16 g/mol |
| IUPAC name | 3-(2,2-difluoroethoxy)-5-nitroaniline |
| InChIKey | NKVLRUWGBCMVPU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])OCC(F)F)N |
Computed by PubChem (NCBI)