Products 2413477-14-0
CAS 2413477-14-0 is the registry number for 4-Ethynylbenzyl (S)-2-(6-methoxynaphthalen-2-yl)propanoate, 98%. Offered by: Fluorochem. Available pack sizes: 100mg.
(4-ethynylphenyl)methyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate (CAS 2413477-14-0) is a chemical compound with the molecular formula C23H20O3 and a molecular weight of 344.4 g/mol. IUPAC name: (4-ethynylphenyl)methyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate. InChIKey: IHNVAAFNIUEEFG-INIZCTEOSA-N.
| Molecular formula | C23H20O3 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | (4-ethynylphenyl)methyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
| InChIKey | IHNVAAFNIUEEFG-INIZCTEOSA-N |
| SMILES | C[C@@H](C1=CC2=C(C=C1)C=C(C=C2)OC)C(=O)OCC3=CC=C(C=C3)C#C |
Computed by PubChem (NCBI)