CAS 1002798-81-3 is the registry number for (E)-1-([1,1'-Biphenyl]-4-yl)-3-(2,3-dimethoxyphenyl)prop-2-en-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-(2,3-dimethoxyphenyl)-1-(4-phenylphenyl)prop-2-en-1-one (CAS 1002798-81-3) is a chemical compound with the molecular formula C23H20O3 and a molecular weight of 344.4 g/mol. IUPAC name: (E)-3-(2,3-dimethoxyphenyl)-1-(4-phenylphenyl)prop-2-en-1-one. InChIKey: QBSGVRMDMXPMIE-FOCLMDBBSA-N.
| Molecular formula | C23H20O3 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | (E)-3-(2,3-dimethoxyphenyl)-1-(4-phenylphenyl)prop-2-en-1-one |
| InChIKey | QBSGVRMDMXPMIE-FOCLMDBBSA-N |
| SMILES | COC1=CC=CC(=C1OC)/C=C/C(=O)C2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)