CAS 1019984-44-1 is the registry number for TLR4-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-methoxy-2-(4-methoxyphenyl)-3-phenyl-2,3-dihydroinden-1-one (CAS 1019984-44-1) is a chemical compound with the molecular formula C23H20O3 and a molecular weight of 344.4 g/mol. IUPAC name: 5-methoxy-2-(4-methoxyphenyl)-3-phenyl-2,3-dihydroinden-1-one. InChIKey: RFAZNDRBXSBRNO-UHFFFAOYSA-N.
| Molecular formula | C23H20O3 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 5-methoxy-2-(4-methoxyphenyl)-3-phenyl-2,3-dihydroinden-1-one |
| InChIKey | RFAZNDRBXSBRNO-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2C(C3=C(C2=O)C=CC(=C3)OC)C4=CC=CC=C4 |
Computed by PubChem (NCBI)