Products 2413648-96-9
CAS 2413648-96-9 is the registry number for EV-A71-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-imidazo[1,2-a]pyrimidin-3-yl-N-(4-phenylphenyl)-1,3-thiazol-2-amine (CAS 2413648-96-9) is a chemical compound with the molecular formula C21H15N5S and a molecular weight of 369.4 g/mol. IUPAC name: 4-imidazo[1,2-a]pyrimidin-3-yl-N-(4-phenylphenyl)-1,3-thiazol-2-amine. InChIKey: RLAGELDZWDHQJS-UHFFFAOYSA-N.
| Molecular formula | C21H15N5S |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | 4-imidazo[1,2-a]pyrimidin-3-yl-N-(4-phenylphenyl)-1,3-thiazol-2-amine |
| InChIKey | RLAGELDZWDHQJS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC3=NC(=CS3)C4=CN=C5N4C=CC=N5 |
Computed by PubChem (NCBI)