Products 517906-12-6
CAS 517906-12-6 is the registry number for Urease-IN-11. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(4-phenylphenyl)-3-pyridin-3-yl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine (CAS 517906-12-6) is a chemical compound with the molecular formula C21H15N5S and a molecular weight of 369.4 g/mol. IUPAC name: 6-(4-phenylphenyl)-3-pyridin-3-yl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine. InChIKey: RKABLEANQKUEMP-UHFFFAOYSA-N.
| Molecular formula | C21H15N5S |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | 6-(4-phenylphenyl)-3-pyridin-3-yl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| InChIKey | RKABLEANQKUEMP-UHFFFAOYSA-N |
| SMILES | C1C(=NN2C(=NN=C2S1)C3=CN=CC=C3)C4=CC=C(C=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)