Products 2413695-26-6
CAS 2413695-26-6 is the registry number for Methylboronic acid pinacol ester-d3. Offered by: MedChemExpress. Available pack sizes: 5 mg, 25 mg, 10 mg, 50 mg.
4,4,5,5-tetramethyl-2-(trideuteriomethyl)-1,3,2-dioxaborolane (CAS 2413695-26-6) is a chemical compound with the molecular formula C7H15BO2 and a molecular weight of 145.02 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(trideuteriomethyl)-1,3,2-dioxaborolane. InChIKey: FOQJHZPURACERJ-VPYROQPTSA-N.
| Molecular formula | C7H15BO2 |
|---|---|
| Molecular weight | 145.02 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(trideuteriomethyl)-1,3,2-dioxaborolane |
| InChIKey | FOQJHZPURACERJ-VPYROQPTSA-N |
| SMILES | [2H]C([2H])([2H])B1OC(C(O1)(C)C)(C)C |
Computed by PubChem (NCBI)