CAS 680600-46-8 appears in our catalog under these names: (trans-2-(tert-Butyl)cyclopropyl)boronic acid, 98+%, (2–(tert–butyl)cyclopropyl)boronic acid. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 100mg, 25mg.
[(1R,2R)-2-tert-butylcyclopropyl]boronic acid (CAS 680600-46-8) is a chemical compound with the molecular formula C7H15BO2 and a molecular weight of 142.01 g/mol. IUPAC name: [(1R,2R)-2-tert-butylcyclopropyl]boronic acid. InChIKey: UPPDXDIPPWGOAC-PHDIDXHHSA-N.
| Molecular formula | C7H15BO2 |
|---|---|
| Molecular weight | 142.01 g/mol |
| IUPAC name | [(1R,2R)-2-tert-butylcyclopropyl]boronic acid |
| InChIKey | UPPDXDIPPWGOAC-PHDIDXHHSA-N |
| SMILES | B([C@@H]1C[C@H]1C(C)(C)C)(O)O |
Computed by PubChem (NCBI)