Products 2413880-39-2
CAS 2413880-39-2 is the registry number for Steroid sulfatase-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-(adamantane-1-carbonylamino)phenyl] sulfamate (CAS 2413880-39-2) is a chemical compound with the molecular formula C17H22N2O4S and a molecular weight of 350.4 g/mol. IUPAC name: [4-(adamantane-1-carbonylamino)phenyl] sulfamate. InChIKey: GVPUYCLSISISPD-UHFFFAOYSA-N.
| Molecular formula | C17H22N2O4S |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | [4-(adamantane-1-carbonylamino)phenyl] sulfamate |
| InChIKey | GVPUYCLSISISPD-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C(=O)NC4=CC=C(C=C4)OS(=O)(=O)N |
Computed by PubChem (NCBI)
Synonyms:
Steroid sulfatase-IN-2, orb1688826