Products 2414374-41-5
CAS 2414374-41-5 appears in our catalog under these names: EMI56, EMI56, 99.36%, EMI56, 99.72%. Offered by: GLPBio, TargetMol, Biosynth, MedChemExpress, Chemat. Available pack sizes: 5mg, 10mg, 100mg, 10mM (in 1ml dmso), 25mg, 50mg, 2mg, 100 mg.
3-(1,3-benzoxazol-2-yl)-7-(diethylamino)-6-methylchromen-2-one (CAS 2414374-41-5) is a chemical compound with the molecular formula C21H20N2O3 and a molecular weight of 348.4 g/mol. IUPAC name: 3-(1,3-benzoxazol-2-yl)-7-(diethylamino)-6-methylchromen-2-one. InChIKey: OYQNORRYAWXDHW-UHFFFAOYSA-N.
| Molecular formula | C21H20N2O3 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 3-(1,3-benzoxazol-2-yl)-7-(diethylamino)-6-methylchromen-2-one |
| InChIKey | OYQNORRYAWXDHW-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1C)C=C(C(=O)O2)C3=NC4=CC=CC=C4O3 |
Computed by PubChem (NCBI)