CAS 332019-32-6 is the registry number for 2,2,4-Trimethyl-1-[3-(4-nitrophenyl)acryloyl]-1,2-dihydroquinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(E)-3-(4-nitrophenyl)-1-(2,2,4-trimethylquinolin-1-yl)prop-2-en-1-one (CAS 332019-32-6) is a chemical compound with the molecular formula C21H20N2O3 and a molecular weight of 348.4 g/mol. IUPAC name: (E)-3-(4-nitrophenyl)-1-(2,2,4-trimethylquinolin-1-yl)prop-2-en-1-one. InChIKey: QYMYAEKFTXPOQF-JLHYYAGUSA-N.
| Molecular formula | C21H20N2O3 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | (E)-3-(4-nitrophenyl)-1-(2,2,4-trimethylquinolin-1-yl)prop-2-en-1-one |
| InChIKey | QYMYAEKFTXPOQF-JLHYYAGUSA-N |
| SMILES | CC1=CC(N(C2=CC=CC=C12)C(=O)/C=C/C3=CC=C(C=C3)[N+](=O)[O-])(C)C |
Computed by PubChem (NCBI)