CAS 2415337-01-6 appears in our catalog under these names: 4'–Bromospiro(adamantane–2,9'–fluorene), 4'-Bromospiro[adamantane-2,9'-fluorene], 97%, 97%, 4'-Bromospiro[adamantane-2,9'-fluorene], 98%(GC-MS),RG, 4'-Bromospiro[adamantane-2,9'-fluorene], 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
4'-bromospiro[adamantane-2,9'-fluorene] (CAS 2415337-01-6) is a chemical compound with the molecular formula C22H21Br and a molecular weight of 365.3 g/mol. IUPAC name: 4'-bromospiro[adamantane-2,9'-fluorene]. InChIKey: QGQSZWNWWFSYMK-UHFFFAOYSA-N.
| Molecular formula | C22H21Br |
|---|---|
| Molecular weight | 365.3 g/mol |
| IUPAC name | 4'-bromospiro[adamantane-2,9'-fluorene] |
| InChIKey | QGQSZWNWWFSYMK-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)C34C5=C(C6=CC=CC=C46)C(=CC=C5)Br |
Computed by PubChem (NCBI)