CAS 2629304-33-0 is the registry number for 3'-Bromospiro[adamantane-2,9'-fluorene], 95%(GC),RG, 95%(GC),RG. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
3'-bromospiro[adamantane-2,9'-fluorene] (CAS 2629304-33-0) is a chemical compound with the molecular formula C22H21Br and a molecular weight of 365.3 g/mol. IUPAC name: 3'-bromospiro[adamantane-2,9'-fluorene]. InChIKey: CXGFBDSLGTVINQ-UHFFFAOYSA-N.
| Molecular formula | C22H21Br |
|---|---|
| Molecular weight | 365.3 g/mol |
| IUPAC name | 3'-bromospiro[adamantane-2,9'-fluorene] |
| InChIKey | CXGFBDSLGTVINQ-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)C34C5=C(C=C(C=C5)Br)C6=CC=CC=C46 |
Computed by PubChem (NCBI)