CAS 2415766-93-5 is the registry number for 3-[(2-Phenylethyl)sulfinyl]-1h-1,2,4-triazol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
5-(2-phenylethylsulfinyl)-1H-1,2,4-triazol-3-amine (CAS 2415766-93-5) is a chemical compound with the molecular formula C10H12N4OS and a molecular weight of 236.30 g/mol. IUPAC name: 5-(2-phenylethylsulfinyl)-1H-1,2,4-triazol-3-amine. InChIKey: HQPBAAVTAWAWRF-UHFFFAOYSA-N.
| Molecular formula | C10H12N4OS |
|---|---|
| Molecular weight | 236.30 g/mol |
| IUPAC name | 5-(2-phenylethylsulfinyl)-1H-1,2,4-triazol-3-amine |
| InChIKey | HQPBAAVTAWAWRF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCS(=O)C2=NC(=NN2)N |
Computed by PubChem (NCBI)