CAS 930861-26-0 is the registry number for 6-Methyl-2-(((5-methylisoxazol-3-yl)methyl)thio)pyrimidin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-methyl-2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]pyrimidin-4-amine (CAS 930861-26-0) is a chemical compound with the molecular formula C10H12N4OS and a molecular weight of 236.30 g/mol. IUPAC name: 6-methyl-2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]pyrimidin-4-amine. InChIKey: FAOJATPECYMFOR-UHFFFAOYSA-N.
| Molecular formula | C10H12N4OS |
|---|---|
| Molecular weight | 236.30 g/mol |
| IUPAC name | 6-methyl-2-[(5-methyl-1,2-oxazol-3-yl)methylsulfanyl]pyrimidin-4-amine |
| InChIKey | FAOJATPECYMFOR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)SCC2=NOC(=C2)C)N |
Computed by PubChem (NCBI)