Products 2415803-90-4
CAS 2415803-90-4 is the registry number for 2-Morpholin-4-yl-2-oxo-1-(2,2,4,6-tetramethyl-1,2-dihydroquinolin-8-yl)ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-morpholin-4-yl-2-(2,2,4,6-tetramethyl-1H-quinolin-8-yl)ethane-1,2-dione (CAS 2415803-90-4) is a chemical compound with the molecular formula C19H24N2O3 and a molecular weight of 328.4 g/mol. IUPAC name: 1-morpholin-4-yl-2-(2,2,4,6-tetramethyl-1H-quinolin-8-yl)ethane-1,2-dione. InChIKey: CSAWMXPHPJFRGY-UHFFFAOYSA-N.
| Molecular formula | C19H24N2O3 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | 1-morpholin-4-yl-2-(2,2,4,6-tetramethyl-1H-quinolin-8-yl)ethane-1,2-dione |
| InChIKey | CSAWMXPHPJFRGY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)C(=O)C(=O)N3CCOCC3)NC(C=C2C)(C)C |
Computed by PubChem (NCBI)