CAS 477552-93-5 appears in our catalog under these names: Formoterol Impurity 5, ArforMoterol Tartrate Impurity 2, Formoterol Impurity 25, rac-Deshydroxy Formoterol, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
N-[2-hydroxy-5-[2-[1-(4-methoxyphenyl)propan-2-ylamino]ethyl]phenyl]formamide (CAS 477552-93-5) is a chemical compound with the molecular formula C19H24N2O3 and a molecular weight of 328.4 g/mol. IUPAC name: N-[2-hydroxy-5-[2-[1-(4-methoxyphenyl)propan-2-ylamino]ethyl]phenyl]formamide. InChIKey: OROKZPUWZCRYFD-UHFFFAOYSA-N.
| Molecular formula | C19H24N2O3 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | N-[2-hydroxy-5-[2-[1-(4-methoxyphenyl)propan-2-ylamino]ethyl]phenyl]formamide |
| InChIKey | OROKZPUWZCRYFD-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC=C(C=C1)OC)NCCC2=CC(=C(C=C2)O)NC=O |
Computed by PubChem (NCBI)