CAS 2416-02-6 is the registry number for 3'-Bromo-2,2-dimethylpropiophenone, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 100mg.
1-(3-bromophenyl)-2,2-dimethylpropan-1-one (CAS 2416-02-6) is a chemical compound with the molecular formula C11H13BrO and a molecular weight of 241.12 g/mol. IUPAC name: 1-(3-bromophenyl)-2,2-dimethylpropan-1-one. InChIKey: GPTFTXOKQHQUTL-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO |
|---|---|
| Molecular weight | 241.12 g/mol |
| IUPAC name | 1-(3-bromophenyl)-2,2-dimethylpropan-1-one |
| InChIKey | GPTFTXOKQHQUTL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)