CAS 2416991-78-9 is the registry number for Pitolisant-d6 HCl. Offered by: Chemat Brand. Available pack sizes: on request.
1-[3-[3-(4-chlorophenyl)propoxy]-1,1,2,2,3,3-hexadeuteriopropyl]piperidine;hydrochloride (CAS 2416991-78-9) is a chemical compound with the molecular formula C17H27Cl2NO and a molecular weight of 338.3 g/mol. IUPAC name: 1-[3-[3-(4-chlorophenyl)propoxy]-1,1,2,2,3,3-hexadeuteriopropyl]piperidine;hydrochloride. InChIKey: XLFKECRRMPOAQS-IARPTNQUSA-N.
| Molecular formula | C17H27Cl2NO |
|---|---|
| Molecular weight | 338.3 g/mol |
| IUPAC name | 1-[3-[3-(4-chlorophenyl)propoxy]-1,1,2,2,3,3-hexadeuteriopropyl]piperidine;hydrochloride |
| InChIKey | XLFKECRRMPOAQS-IARPTNQUSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])N1CCCCC1)C([2H])([2H])OCCCC2=CC=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)