CAS 903576-44-3 appears in our catalog under these names: 1-[3-[3-(4-Chlorophenyl)propoxy]propyl]piperidine hydrochloride, 99%, 99%, Pitolisant hydrochloride, 98%, Pitolisant HCl, BF 2649 Hydrochloride, Pitolisant hydrochloride. Offered by: Chemat, Combi-blocks, Chemat Brand, TRC, GLPBio. Available pack sizes: 1mg, 10mg, 50mg, 100mg, 250mg, 1g, 5g, on request.
1-[3-[3-(4-chlorophenyl)propoxy]propyl]piperidine;hydrochloride (CAS 903576-44-3) is a chemical compound with the molecular formula C17H27Cl2NO and a molecular weight of 332.3 g/mol. IUPAC name: 1-[3-[3-(4-chlorophenyl)propoxy]propyl]piperidine;hydrochloride. InChIKey: XLFKECRRMPOAQS-UHFFFAOYSA-N.
| Molecular formula | C17H27Cl2NO |
|---|---|
| Molecular weight | 332.3 g/mol |
| IUPAC name | 1-[3-[3-(4-chlorophenyl)propoxy]propyl]piperidine;hydrochloride |
| InChIKey | XLFKECRRMPOAQS-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CCCOCCCC2=CC=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)