CAS 2417969-80-1 is the registry number for Benzyl 6-bromo-1,2,2a,7b-tetrahydro-3H-cyclobuta[b]indole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl 6-bromo-1,2,2a,7b-tetrahydrocyclobuta[b]indole-3-carboxylate (CAS 2417969-80-1) is a chemical compound with the molecular formula C18H16BrNO2 and a molecular weight of 358.2 g/mol. IUPAC name: benzyl 6-bromo-1,2,2a,7b-tetrahydrocyclobuta[b]indole-3-carboxylate. InChIKey: JCVOQYNSQHBHDK-UHFFFAOYSA-N.
| Molecular formula | C18H16BrNO2 |
|---|---|
| Molecular weight | 358.2 g/mol |
| IUPAC name | benzyl 6-bromo-1,2,2a,7b-tetrahydrocyclobuta[b]indole-3-carboxylate |
| InChIKey | JCVOQYNSQHBHDK-UHFFFAOYSA-N |
| SMILES | C1CC2C1C3=C(N2C(=O)OCC4=CC=CC=C4)C=CC(=C3)Br |
Computed by PubChem (NCBI)