Products 854137-59-0

CAS 854137-59-0 appears in our catalog under these names: 3-(2-(4-Bromophenyl)-5-methyl-1H-indol-3-yl)propanoic acid, 95%, 3-(2-(4-Bromophenyl)-5-methyl-1H-indol-3-yl)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.

Structural formula: {0} (CAS {1})

3-[2-(4-bromophenyl)-5-methyl-1H-indol-3-yl]propanoic acid (CAS 854137-59-0) is a chemical compound with the molecular formula C18H16BrNO2 and a molecular weight of 358.2 g/mol. IUPAC name: 3-[2-(4-bromophenyl)-5-methyl-1H-indol-3-yl]propanoic acid. InChIKey: RRSWERNCECUOJF-UHFFFAOYSA-N.

Identity
Molecular formulaC18H16BrNO2
Molecular weight358.2 g/mol
IUPAC name3-[2-(4-bromophenyl)-5-methyl-1H-indol-3-yl]propanoic acid
InChIKeyRRSWERNCECUOJF-UHFFFAOYSA-N
SMILESCC1=CC2=C(C=C1)NC(=C2CCC(=O)O)C3=CC=C(C=C3)Br

Computed by PubChem (NCBI)