Products 241798-68-5
CAS 241798-68-5 appears in our catalog under these names: 5-Cyclopropyl-1-phenyl-1h-pyrazole-4-carboxylic acid, 98%, 5-Cyclopropyl-1-phenyl-1H-pyrazole-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g, 250mg, 2,5g.
5-cyclopropyl-1-phenylpyrazole-4-carboxylic acid (CAS 241798-68-5) is a chemical compound with the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. IUPAC name: 5-cyclopropyl-1-phenylpyrazole-4-carboxylic acid. InChIKey: GOFLYUKBUGVGJT-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2 |
|---|---|
| Molecular weight | 228.25 g/mol |
| IUPAC name | 5-cyclopropyl-1-phenylpyrazole-4-carboxylic acid |
| InChIKey | GOFLYUKBUGVGJT-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(C=NN2C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)