Products 24182-44-3

CAS 24182-44-3 is the registry number for 2-(Benzyloxy)-2-(ethoxycarbonyl)-3-methylbutanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-ethoxycarbonyl-3-methyl-2-phenylmethoxybutanoic acid (CAS 24182-44-3) is a chemical compound with the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. IUPAC name: 2-ethoxycarbonyl-3-methyl-2-phenylmethoxybutanoic acid. InChIKey: IVIUCVPWPODFER-UHFFFAOYSA-N.

Identity
Molecular formulaC15H20O5
Molecular weight280.32 g/mol
IUPAC name2-ethoxycarbonyl-3-methyl-2-phenylmethoxybutanoic acid
InChIKeyIVIUCVPWPODFER-UHFFFAOYSA-N
SMILESCCOC(=O)C(C(C)C)(C(=O)O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)