Products 47033-36-3
CAS 47033-36-3 is the registry number for (S)-2-(Benzyloxy)-2-(ethoxycarbonyl)-3-methylbutanoic acid (l isomer), 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2S)-2-ethoxycarbonyl-3-methyl-2-phenylmethoxybutanoic acid (CAS 47033-36-3) is a chemical compound with the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. IUPAC name: (2S)-2-ethoxycarbonyl-3-methyl-2-phenylmethoxybutanoic acid. InChIKey: IVIUCVPWPODFER-HNNXBMFYSA-N.
| Molecular formula | C15H20O5 |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | (2S)-2-ethoxycarbonyl-3-methyl-2-phenylmethoxybutanoic acid |
| InChIKey | IVIUCVPWPODFER-HNNXBMFYSA-N |
| SMILES | CCOC(=O)[C@](C(C)C)(C(=O)O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)