CAS 2418528-30-8 appears in our catalog under these names: 2-chloro-4-(dibenzo[b,d]furan-1-yl)-6-(naphthalen-2-yl)-1,3,5-triazine, 98%, 2-Chloro-4-(dibenzofuran-1-yl)-6-(naphthalen-2-yl)-1,3,5-triazine, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
2-chloro-4-dibenzofuran-1-yl-6-naphthalen-2-yl-1,3,5-triazine (CAS 2418528-30-8) is a chemical compound with the molecular formula C25H14ClN3O and a molecular weight of 407.8 g/mol. IUPAC name: 2-chloro-4-dibenzofuran-1-yl-6-naphthalen-2-yl-1,3,5-triazine. InChIKey: NRAJAGYKPHUQMD-UHFFFAOYSA-N.
| Molecular formula | C25H14ClN3O |
|---|---|
| Molecular weight | 407.8 g/mol |
| IUPAC name | 2-chloro-4-dibenzofuran-1-yl-6-naphthalen-2-yl-1,3,5-triazine |
| InChIKey | NRAJAGYKPHUQMD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=NC(=NC(=N3)Cl)C4=C5C6=CC=CC=C6OC5=CC=C4 |
Computed by PubChem (NCBI)