CAS 2454305-80-5 is the registry number for 2-Chloro-4-(naphtho[2,3-b]benzofuran-1-yl)-6-phenyl-1,3,5-triazine, 95%. Offered by: Ambeed. Available pack sizes: 1g, 5g, 25g.
2-chloro-4-naphtho[2,3-b][1]benzofuran-1-yl-6-phenyl-1,3,5-triazine (CAS 2454305-80-5) is a chemical compound with the molecular formula C25H14ClN3O and a molecular weight of 407.8 g/mol. IUPAC name: 2-chloro-4-naphtho[2,3-b][1]benzofuran-1-yl-6-phenyl-1,3,5-triazine. InChIKey: OIRWTLOIOOQSFQ-UHFFFAOYSA-N.
| Molecular formula | C25H14ClN3O |
|---|---|
| Molecular weight | 407.8 g/mol |
| IUPAC name | 2-chloro-4-naphtho[2,3-b][1]benzofuran-1-yl-6-phenyl-1,3,5-triazine |
| InChIKey | OIRWTLOIOOQSFQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)Cl)C3=C4C(=CC=C3)OC5=CC6=CC=CC=C6C=C54 |
Computed by PubChem (NCBI)