CAS 2418567-26-5 is the registry number for 2-Amino-5-chloro-6-methoxynicotinic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-amino-5-chloro-6-methoxypyridine-3-carboxylic acid (CAS 2418567-26-5) is a chemical compound with the molecular formula C7H7ClN2O3 and a molecular weight of 202.59 g/mol. IUPAC name: 2-amino-5-chloro-6-methoxypyridine-3-carboxylic acid. InChIKey: UOFIIMTZSIMALY-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O3 |
|---|---|
| Molecular weight | 202.59 g/mol |
| IUPAC name | 2-amino-5-chloro-6-methoxypyridine-3-carboxylic acid |
| InChIKey | UOFIIMTZSIMALY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=N1)N)C(=O)O)Cl |
Computed by PubChem (NCBI)