CAS 2420-87-3 appears in our catalog under these names: 4,4'-Biphthalic Anhydride (purified by sublimation), >98.0%(HPLC), 4,4'-Biphthalic anhydride, 4,4'-Biphthalic Anhydride, >98.0%(T), 4,4'-Biphthalic anhydride 97%, 3,3',4,4'-BIPHENYLTETRACARBOXYLIC DI- &. Offered by: TCI, Biosynth, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 5g, 5kg, 1kg, 25g, 100g, 10kg, 500g, 1000g.
5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione (CAS 2420-87-3) is a chemical compound with the molecular formula C16H6O6 and a molecular weight of 294.21 g/mol. IUPAC name: 5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione. InChIKey: WKDNYTOXBCRNPV-UHFFFAOYSA-N.
| Molecular formula | C16H6O6 |
|---|---|
| Molecular weight | 294.21 g/mol |
| IUPAC name | 5-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione |
| InChIKey | WKDNYTOXBCRNPV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C3=CC4=C(C=C3)C(=O)OC4=O)C(=O)OC2=O |
Computed by PubChem (NCBI)