CAS 36978-41-3 appears in our catalog under these names: 2,3,3′,4′–biphenyl tetracarboxylic dianhydride, 3,4'-Biphthalic Anhydride, >98.0%(GC), 2,3,3,4-biphenyl tetracarboxylic dianhydride 98%, [4,5'-Biisobenzofuran]-1,1',3,3'-tetraone, 98%(HPLC), 98%(HPLC), [4,5'-Biisobenzofuran]-1,1',3,3'-tetraone, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 500g, 1000g, 1g, 10g, 15g.
4-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione (CAS 36978-41-3) is a chemical compound with the molecular formula C16H6O6 and a molecular weight of 294.21 g/mol. IUPAC name: 4-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione. InChIKey: FYYYKXFEKMGYLZ-UHFFFAOYSA-N.
| Molecular formula | C16H6O6 |
|---|---|
| Molecular weight | 294.21 g/mol |
| IUPAC name | 4-(1,3-dioxo-2-benzofuran-5-yl)-2-benzofuran-1,3-dione |
| InChIKey | FYYYKXFEKMGYLZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)C(=O)OC2=O)C3=CC4=C(C=C3)C(=O)OC4=O |
Computed by PubChem (NCBI)