CAS 2424-75-1 appears in our catalog under these names: Dimenoxadol Hydrochloride, >95% (HPLC), Estocin. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 50mg, 5mg, 10mg, 25mg.
2-(2-ethoxy-2,2-diphenylacetyl)oxyethyl-dimethylazanium chloride (CAS 2424-75-1) is a chemical compound with the molecular formula C20H26ClNO3 and a molecular weight of 363.9 g/mol. IUPAC name: 2-(2-ethoxy-2,2-diphenylacetyl)oxyethyl-dimethylazanium chloride. InChIKey: ZFUFAMMRSGTUQO-UHFFFAOYSA-N.
| Molecular formula | C20H26ClNO3 |
|---|---|
| Molecular weight | 363.9 g/mol |
| IUPAC name | 2-(2-ethoxy-2,2-diphenylacetyl)oxyethyl-dimethylazanium chloride |
| InChIKey | ZFUFAMMRSGTUQO-UHFFFAOYSA-N |
| SMILES | CCOC(C1=CC=CC=C1)(C2=CC=CC=C2)C(=O)OCC[NH+](C)C.[Cl-] |
Computed by PubChem (NCBI)