Products 57-37-4
CAS 57-37-4 appears in our catalog under these names: Benactyzine Hydrochloride, >95% (HPLC), Benactyzine Hydrochloride, Benactyzine hydrochloride/ 99.68% (existing batch purity), Benactyzine hydrochloride, Benactyzine Hydrochloride, >98.0%(HPLC)(T). Offered by: TRC, Mikromol, LoGiCal, TargetMol, GLPBio. Available pack sizes: 50g, 5g, 100mg, 10mg, 200mg, 10mM (in 1ml dmso), 1g, 1mg.
2-(diethylamino)ethyl 2-hydroxy-2,2-diphenylacetate;hydrochloride (CAS 57-37-4) is a chemical compound with the molecular formula C20H26ClNO3 and a molecular weight of 363.9 g/mol. IUPAC name: 2-(diethylamino)ethyl 2-hydroxy-2,2-diphenylacetate;hydrochloride. InChIKey: ZCEHOOLYWQBGQO-UHFFFAOYSA-N.
| Molecular formula | C20H26ClNO3 |
|---|---|
| Molecular weight | 363.9 g/mol |
| IUPAC name | 2-(diethylamino)ethyl 2-hydroxy-2,2-diphenylacetate;hydrochloride |
| InChIKey | ZCEHOOLYWQBGQO-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOC(=O)C(C1=CC=CC=C1)(C2=CC=CC=C2)O.Cl |
Computed by PubChem (NCBI)