CAS 24243-32-1 appears in our catalog under these names: Benzo[1,2-b:6,5-b']dithiophene-4,5-dione, 98%, 98%, benzo[2,1-b:3,4-b']dithiophene-4,5-dione, 97%, Benzo[1,2-b:6,5-b']dithiophene-4,5-dione, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g, 25g.
Thieno[3,2-g][1]benzothiole-4,5-dione (CAS 24243-32-1) is a chemical compound with the molecular formula C10H4O2S2 and a molecular weight of 220.3 g/mol. IUPAC name: thieno[3,2-g][1]benzothiole-4,5-dione. InChIKey: HRKPZDPFRDQSKZ-UHFFFAOYSA-N.
| Molecular formula | C10H4O2S2 |
|---|---|
| Molecular weight | 220.3 g/mol |
| IUPAC name | thieno[3,2-g][1]benzothiole-4,5-dione |
| InChIKey | HRKPZDPFRDQSKZ-UHFFFAOYSA-N |
| SMILES | C1=CSC2=C1C(=O)C(=O)C3=C2SC=C3 |
Computed by PubChem (NCBI)